C22H30FN5O2 — CID 139324479
6-fluoro-N'-(1-hydroxyethyl)-2-[4-(oxan-4-ylamino)piperidin-1-yl]quinoline-3-carboximidamide (PubChem CID 139324479) has the molecular formula C22H30FN5O2 and a molecular weight of 415.51 g/mol. Its IUPAC name is 6-fluoro-N'-(1-hydroxyethyl)-2-[4-(oxan-4-ylamino)piperidin-1-yl]quinoline-3-carboximidamide.
| Compound Name | 6-fluoro-N'-(1-hydroxyethyl)-2-[4-(oxan-4-ylamino)piperidin-1-yl]quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 139324479 |
| Molecular Formula | C22H30FN5O2 |
| Molecular Weight | 415.51 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 6-fluoro-N'-(1-hydroxyethyl)-2-[4-(oxan-4-ylamino)piperidin-1-yl]quinoline-3-carboximidamide |
| SMILES | CC(O)/N=C(\N)c1cc2cc(F)ccc2nc1N1CCC(NC2CCOCC2)CC1 |
| InChI | InChI=1S/C22H30FN5O2/c1-14(29)25-21(24)19-13-15-12-16(23)2-3-20(15)27-22(19)28-8-4-17(5-9-28)26-18-6-10-30-11-7-18/h2-3,12-14,17-18,26,29H,4-11H2,1H3,(H2,24,25) |
| InChIKey | NPVLKGMAAOEGLD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 96.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.51 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|