C24H36N5O+ — CID 144575717
[(Z)-N-[amino(cyclopropyl)methyl]-C-[6-methyl-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium (PubChem CID 144575717) has the molecular formula C24H36N5O+ and a molecular weight of 410.59 g/mol. Its IUPAC name is [(Z)-N-[amino(cyclopropyl)methyl]-C-[6-methyl-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium.
| Compound Name | [(Z)-N-[amino(cyclopropyl)methyl]-C-[6-methyl-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 144575717 |
| Molecular Formula | C24H36N5O+ |
| Molecular Weight | 410.59 g/mol |
| Exact Mass | 410.29 |
| IUPAC Name | [(Z)-N-[amino(cyclopropyl)methyl]-C-[6-methyl-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
| SMILES | Cc1ccc2nc(N3CCC(NCC(C)C)CC3)c(/C([OH2+])=N/C(N)C3CC3)cc2c1 |
| InChI | InChI=1S/C24H35N5O/c1-15(2)14-26-19-8-10-29(11-9-19)23-20(24(30)28-22(25)17-5-6-17)13-18-12-16(3)4-7-21(18)27-23/h4,7,12-13,15,17,19,22,26H,5-6,8-11,14,25H2,1-3H3,(H,28,30)/p+1 |
| InChIKey | ZATNEVOQCQGFPL-UHFFFAOYSA-O |
| XLogP | 2.92 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.59 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|