C27H38N5O+ — CID 144575591
[N-ethanimidoyl-C-[6-methyl-2-[4-(spiro[2.5]octan-8-ylmethylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium (PubChem CID 144575591) has the molecular formula C27H38N5O+ and a molecular weight of 448.64 g/mol. Its IUPAC name is [N-ethanimidoyl-C-[6-methyl-2-[4-(spiro[2.5]octan-8-ylmethylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium.
| Compound Name | [N-ethanimidoyl-C-[6-methyl-2-[4-(spiro[2.5]octan-8-ylmethylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 144575591 |
| Molecular Formula | C27H38N5O+ |
| Molecular Weight | 448.64 g/mol |
| Exact Mass | 448.31 |
| IUPAC Name | [N-ethanimidoyl-C-[6-methyl-2-[4-(spiro[2.5]octan-8-ylmethylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
| SMILES | [H]/N=C(C)/N=C(\[OH2+])c1cc2cc(C)ccc2nc1N1CCC(NCC2CCCCC23CC3)CC1 |
| InChI | InChI=1S/C27H37N5O/c1-18-6-7-24-20(15-18)16-23(26(33)30-19(2)28)25(31-24)32-13-8-22(9-14-32)29-17-21-5-3-4-10-27(21)11-12-27/h6-7,15-16,21-22,29H,3-5,8-14,17H2,1-2H3,(H2,28,30,33)/p+1 |
| InChIKey | INGWZLUCVCTQKN-UHFFFAOYSA-O |
| XLogP | 4.54 |
| TPSA | 87.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|