C22H31N5O2 — CID 123963874
N-(1-aminoethyl)-6-methyl-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide (PubChem CID 123963874) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(1-aminoethyl)-6-methyl-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-6-methyl-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 123963874 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-(1-aminoethyl)-6-methyl-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(N3CCC(NC4CCOC4)CC3)c(C(=O)NC(C)N)cc2c1 |
| InChI | InChI=1S/C22H31N5O2/c1-14-3-4-20-16(11-14)12-19(22(28)24-15(2)23)21(26-20)27-8-5-17(6-9-27)25-18-7-10-29-13-18/h3-4,11-12,15,17-18,25H,5-10,13,23H2,1-2H3,(H,24,28) |
| InChIKey | GUDFNRPAAFPGEZ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|