C25H37N5O2 — CID 123980441
N-(1-aminoethyl)-2-[4-(cyclohexylmethyl)-3-(hydroxymethyl)piperazin-1-yl]-6-methylquinoline-3-carboxamide (PubChem CID 123980441) has the molecular formula C25H37N5O2 and a molecular weight of 439.60 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[4-(cyclohexylmethyl)-3-(hydroxymethyl)piperazin-1-yl]-6-methylquinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[4-(cyclohexylmethyl)-3-(hydroxymethyl)piperazin-1-yl]-6-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123980441 |
| Molecular Formula | C25H37N5O2 |
| Molecular Weight | 439.60 g/mol |
| Exact Mass | 439.29 |
| IUPAC Name | N-(1-aminoethyl)-2-[4-(cyclohexylmethyl)-3-(hydroxymethyl)piperazin-1-yl]-6-methylquinoline-3-carboxamide |
| SMILES | Cc1ccc2nc(N3CCN(CC4CCCCC4)C(CO)C3)c(C(=O)NC(C)N)cc2c1 |
| InChI | InChI=1S/C25H37N5O2/c1-17-8-9-23-20(12-17)13-22(25(32)27-18(2)26)24(28-23)30-11-10-29(21(15-30)16-31)14-19-6-4-3-5-7-19/h8-9,12-13,18-19,21,31H,3-7,10-11,14-16,26H2,1-2H3,(H,27,32) |
| InChIKey | GQELBYJKQLWNHK-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 94.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.60 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|