C21H35N5O2 — CID 123966369
N-(1-aminoethyl)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide (PubChem CID 123966369) has the molecular formula C21H35N5O2 and a molecular weight of 389.54 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123966369 |
| Molecular Formula | C21H35N5O2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.28 |
| IUPAC Name | N-(1-aminoethyl)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
| SMILES | COC1CN(c2ncc(C)cc2C(=O)NC(C)N)CCC1NC1CCCCC1 |
| InChI | InChI=1S/C21H35N5O2/c1-14-11-17(21(27)24-15(2)22)20(23-12-14)26-10-9-18(19(13-26)28-3)25-16-7-5-4-6-8-16/h11-12,15-16,18-19,25H,4-10,13,22H2,1-3H3,(H,24,27) |
| InChIKey | NGAJUSVFSAPRKF-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|