C20H33N5O2 — CID 123692323
N-(1-aminoethyl)-2-[4-(cyclopentylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide (PubChem CID 123692323) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[4-(cyclopentylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[4-(cyclopentylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 123692323 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | N-(1-aminoethyl)-2-[4-(cyclopentylamino)-3-methoxypiperidin-1-yl]-5-methylpyridine-3-carboxamide |
| SMILES | COC1CN(c2ncc(C)cc2C(=O)NC(C)N)CCC1NC1CCCC1 |
| InChI | InChI=1S/C20H33N5O2/c1-13-10-16(20(26)23-14(2)21)19(22-11-13)25-9-8-17(18(12-25)27-3)24-15-6-4-5-7-15/h10-11,14-15,17-18,24H,4-9,12,21H2,1-3H3,(H,23,26) |
| InChIKey | DCNNIRFGEDNQHZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|