C23H34N6O2 — CID 139324613
N-(1-aminoethyl)-3-[(3S)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]quinoxaline-2-carboxamide (PubChem CID 139324613) has the molecular formula C23H34N6O2 and a molecular weight of 426.57 g/mol. Its IUPAC name is N-(1-aminoethyl)-3-[(3S)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]quinoxaline-2-carboxamide.
| Compound Name | N-(1-aminoethyl)-3-[(3S)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 139324613 |
| Molecular Formula | C23H34N6O2 |
| Molecular Weight | 426.57 g/mol |
| Exact Mass | 426.27 |
| IUPAC Name | N-(1-aminoethyl)-3-[(3S)-4-(cyclohexylamino)-3-methoxypiperidin-1-yl]quinoxaline-2-carboxamide |
| SMILES | CO[C@H]1CN(c2nc3ccccc3nc2C(=O)NC(C)N)CCC1NC1CCCCC1 |
| InChI | InChI=1S/C23H34N6O2/c1-15(24)25-23(30)21-22(28-18-11-7-6-10-17(18)27-21)29-13-12-19(20(14-29)31-2)26-16-8-4-3-5-9-16/h6-7,10-11,15-16,19-20,26H,3-5,8-9,12-14,24H2,1-2H3,(H,25,30)/t15?,19?,20-/m0/s1 |
| InChIKey | AZMSBXIQFHMJOE-OAAAQFAESA-N |
| XLogP | 2.18 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.57 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|