C26H35N5O — CID 118263913
(3S,4R)-N-cyclohexyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]quinolin-2-yl]-3-methoxypiperidin-4-amine (PubChem CID 118263913) has the molecular formula C26H35N5O and a molecular weight of 433.60 g/mol. Its IUPAC name is (3S,4R)-N-cyclohexyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]quinolin-2-yl]-3-methoxypiperidin-4-amine.
| Compound Name | (3S,4R)-N-cyclohexyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]quinolin-2-yl]-3-methoxypiperidin-4-amine |
|---|---|
| PubChem CID | 118263913 |
| Molecular Formula | C26H35N5O |
| Molecular Weight | 433.60 g/mol |
| Exact Mass | 433.28 |
| IUPAC Name | (3S,4R)-N-cyclohexyl-1-[3-[(Z)-4-iminopent-2-enimidoyl]quinolin-2-yl]-3-methoxypiperidin-4-amine |
| SMILES | [H]/N=C(C)\C=C/C(=N\[H])c1cc2ccccc2nc1N1CC[C@@H](NC2CCCCC2)[C@@H](OC)C1 |
| InChI | InChI=1S/C26H35N5O/c1-18(27)12-13-22(28)21-16-19-8-6-7-11-23(19)30-26(21)31-15-14-24(25(17-31)32-2)29-20-9-4-3-5-10-20/h6-8,11-13,16,20,24-25,27-29H,3-5,9-10,14-15,17H2,1-2H3/b13-12-,27-18-,28-22+/t24-,25+/m1/s1 |
| InChIKey | JBCDDISLVLIRMV-LIXWAIMASA-N |
| XLogP | 4.71 |
| TPSA | 85.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.60 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|