C24H35N5O3 — CID 123907760
N-(1-aminoethyl)-2-[3-methoxy-4-(oxan-4-ylamino)piperidin-1-yl]-6-methylquinoline-3-carboxamide (PubChem CID 123907760) has the molecular formula C24H35N5O3 and a molecular weight of 441.58 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[3-methoxy-4-(oxan-4-ylamino)piperidin-1-yl]-6-methylquinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[3-methoxy-4-(oxan-4-ylamino)piperidin-1-yl]-6-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123907760 |
| Molecular Formula | C24H35N5O3 |
| Molecular Weight | 441.58 g/mol |
| Exact Mass | 441.27 |
| IUPAC Name | N-(1-aminoethyl)-2-[3-methoxy-4-(oxan-4-ylamino)piperidin-1-yl]-6-methylquinoline-3-carboxamide |
| SMILES | COC1CN(c2nc3ccc(C)cc3cc2C(=O)NC(C)N)CCC1NC1CCOCC1 |
| InChI | InChI=1S/C24H35N5O3/c1-15-4-5-20-17(12-15)13-19(24(30)26-16(2)25)23(28-20)29-9-6-21(22(14-29)31-3)27-18-7-10-32-11-8-18/h4-5,12-13,16,18,21-22,27H,6-11,14,25H2,1-3H3,(H,26,30) |
| InChIKey | ZBHCCDDILOCVLU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.58 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|