C21H35N3O2 — CID 144575641
ethane;methyl 2-[4-(cyclohexylamino)piperidin-1-yl]-5-methylpyridine-3-carboxylate (PubChem CID 144575641) has the molecular formula C21H35N3O2 and a molecular weight of 361.53 g/mol. Its IUPAC name is ethane;methyl 2-[4-(cyclohexylamino)piperidin-1-yl]-5-methylpyridine-3-carboxylate.
| Compound Name | ethane;methyl 2-[4-(cyclohexylamino)piperidin-1-yl]-5-methylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 144575641 |
| Molecular Formula | C21H35N3O2 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.27 |
| IUPAC Name | ethane;methyl 2-[4-(cyclohexylamino)piperidin-1-yl]-5-methylpyridine-3-carboxylate |
| SMILES | CC.COC(=O)c1cc(C)cnc1N1CCC(NC2CCCCC2)CC1 |
| InChI | InChI=1S/C19H29N3O2.C2H6/c1-14-12-17(19(23)24-2)18(20-13-14)22-10-8-16(9-11-22)21-15-6-4-3-5-7-15;1-2/h12-13,15-16,21H,3-11H2,1-2H3;1-2H3 |
| InChIKey | HDEDWIYJLNWMPK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |