C20H29N5 — CID 123958418
N-cyclohexyl-1-[5-methyl-3-(1H-pyrazol-5-yl)-2-pyridinyl]piperidin-4-amine (PubChem CID 123958418) has the molecular formula C20H29N5 and a molecular weight of 339.49 g/mol. Its IUPAC name is N-cyclohexyl-1-[5-methyl-3-(1H-pyrazol-5-yl)-2-pyridinyl]piperidin-4-amine.
| Compound Name | N-cyclohexyl-1-[5-methyl-3-(1H-pyrazol-5-yl)-2-pyridinyl]piperidin-4-amine |
|---|---|
| PubChem CID | 123958418 |
| Molecular Formula | C20H29N5 |
| Molecular Weight | 339.49 g/mol |
| Exact Mass | 339.24 |
| IUPAC Name | N-cyclohexyl-1-[5-methyl-3-(1H-pyrazol-5-yl)-2-pyridinyl]piperidin-4-amine |
| SMILES | Cc1cnc(N2CCC(NC3CCCCC3)CC2)c(-c2ccn[nH]2)c1 |
| InChI | InChI=1S/C20H29N5/c1-15-13-18(19-7-10-22-24-19)20(21-14-15)25-11-8-17(9-12-25)23-16-5-3-2-4-6-16/h7,10,13-14,16-17,23H,2-6,8-9,11-12H2,1H3,(H,22,24) |
| InChIKey | CBRVXUSYYOWLEV-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.49 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |