C21H33N5O2 — CID 123214150
N-(1-aminoethyl)-2-[3-(2-hydroxypropylamino)pentylamino]-6-methylquinoline-3-carboxamide (PubChem CID 123214150) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[3-(2-hydroxypropylamino)pentylamino]-6-methylquinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[3-(2-hydroxypropylamino)pentylamino]-6-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123214150 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N-(1-aminoethyl)-2-[3-(2-hydroxypropylamino)pentylamino]-6-methylquinoline-3-carboxamide |
| SMILES | CCC(CCNc1nc2ccc(C)cc2cc1C(=O)NC(C)N)NCC(C)O |
| InChI | InChI=1S/C21H33N5O2/c1-5-17(24-12-14(3)27)8-9-23-20-18(21(28)25-15(4)22)11-16-10-13(2)6-7-19(16)26-20/h6-7,10-11,14-15,17,24,27H,5,8-9,12,22H2,1-4H3,(H,23,26)(H,25,28) |
| InChIKey | WHKHYFFXEDIRKB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 112.30 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|