C22H33N5O2 — CID 139324541
N-(1-aminoethyl)-2-[3-(oxan-3-ylamino)pentylamino]quinoline-3-carboxamide (PubChem CID 139324541) has the molecular formula C22H33N5O2 and a molecular weight of 399.54 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[3-(oxan-3-ylamino)pentylamino]quinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[3-(oxan-3-ylamino)pentylamino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 139324541 |
| Molecular Formula | C22H33N5O2 |
| Molecular Weight | 399.54 g/mol |
| Exact Mass | 399.26 |
| IUPAC Name | N-(1-aminoethyl)-2-[3-(oxan-3-ylamino)pentylamino]quinoline-3-carboxamide |
| SMILES | CCC(CCNc1nc2ccccc2cc1C(=O)NC(C)N)NC1CCCOC1 |
| InChI | InChI=1S/C22H33N5O2/c1-3-17(26-18-8-6-12-29-14-18)10-11-24-21-19(22(28)25-15(2)23)13-16-7-4-5-9-20(16)27-21/h4-5,7,9,13,15,17-18,26H,3,6,8,10-12,14,23H2,1-2H3,(H,24,27)(H,25,28) |
| InChIKey | CZYWSJOIOKQXSM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 101.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.54 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|