C22H36N6O2 — CID 144575636
N-(1-aminoethyl)-7-methyl-3-[3-(oxan-4-ylamino)pentylamino]-3,4-dihydroquinoxaline-2-carboxamide (PubChem CID 144575636) has the molecular formula C22H36N6O2 and a molecular weight of 416.57 g/mol. Its IUPAC name is N-(1-aminoethyl)-7-methyl-3-[3-(oxan-4-ylamino)pentylamino]-3,4-dihydroquinoxaline-2-carboxamide.
| Compound Name | N-(1-aminoethyl)-7-methyl-3-[3-(oxan-4-ylamino)pentylamino]-3,4-dihydroquinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 144575636 |
| Molecular Formula | C22H36N6O2 |
| Molecular Weight | 416.57 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | N-(1-aminoethyl)-7-methyl-3-[3-(oxan-4-ylamino)pentylamino]-3,4-dihydroquinoxaline-2-carboxamide |
| SMILES | CCC(CCNC1Nc2ccc(C)cc2N=C1C(=O)NC(C)N)NC1CCOCC1 |
| InChI | InChI=1S/C22H36N6O2/c1-4-16(26-17-8-11-30-12-9-17)7-10-24-21-20(22(29)25-15(3)23)27-19-13-14(2)5-6-18(19)28-21/h5-6,13,15-17,21,24,26,28H,4,7-12,23H2,1-3H3,(H,25,29) |
| InChIKey | NVIDFPYJPFRVNM-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 112.80 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.57 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|