C23H36N6O2 — CID 139324824
N-(1-aminoethyl)-3-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]quinoxaline-2-carboxamide (PubChem CID 139324824) has the molecular formula C23H36N6O2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(1-aminoethyl)-3-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]quinoxaline-2-carboxamide.
| Compound Name | N-(1-aminoethyl)-3-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]quinoxaline-2-carboxamide |
|---|---|
| PubChem CID | 139324824 |
| Molecular Formula | C23H36N6O2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.29 |
| IUPAC Name | N-(1-aminoethyl)-3-[[3-(cyclohexylamino)-2-(hydroxymethyl)pentyl]amino]quinoxaline-2-carboxamide |
| SMILES | CCC(NC1CCCCC1)C(CO)CNc1nc2ccccc2nc1C(=O)NC(C)N |
| InChI | InChI=1S/C23H36N6O2/c1-3-18(27-17-9-5-4-6-10-17)16(14-30)13-25-22-21(23(31)26-15(2)24)28-19-11-7-8-12-20(19)29-22/h7-8,11-12,15-18,27,30H,3-6,9-10,13-14,24H2,1-2H3,(H,25,29)(H,26,31) |
| InChIKey | OUWAFZHGPXHVKT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 125.19 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|