C25H37N3O3 — CID 123210006
ethyl 2-[[3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinoline-3-carboxylate (PubChem CID 123210006) has the molecular formula C25H37N3O3 and a molecular weight of 427.59 g/mol. Its IUPAC name is ethyl 2-[[3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinoline-3-carboxylate.
| Compound Name | ethyl 2-[[3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinoline-3-carboxylate |
|---|---|
| PubChem CID | 123210006 |
| Molecular Formula | C25H37N3O3 |
| Molecular Weight | 427.59 g/mol |
| Exact Mass | 427.28 |
| IUPAC Name | ethyl 2-[[3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinoline-3-carboxylate |
| SMILES | CCOC(=O)c1cc2cc(C)ccc2nc1NCC(OC)C(CC)NC1CCCCC1 |
| InChI | InChI=1S/C25H37N3O3/c1-5-21(27-19-10-8-7-9-11-19)23(30-4)16-26-24-20(25(29)31-6-2)15-18-14-17(3)12-13-22(18)28-24/h12-15,19,21,23,27H,5-11,16H2,1-4H3,(H,26,28) |
| InChIKey | CEFAQRBZHQAWSB-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 72.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |