C19H26N4O2 — CID 123145374
N-(1-aminoethylidene)-2-(2-methoxypentylamino)-6-methylquinoline-3-carboxamide (PubChem CID 123145374) has the molecular formula C19H26N4O2 and a molecular weight of 342.44 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-(2-methoxypentylamino)-6-methylquinoline-3-carboxamide.
| Compound Name | N-(1-aminoethylidene)-2-(2-methoxypentylamino)-6-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123145374 |
| Molecular Formula | C19H26N4O2 |
| Molecular Weight | 342.44 g/mol |
| Exact Mass | 342.21 |
| IUPAC Name | N-(1-aminoethylidene)-2-(2-methoxypentylamino)-6-methylquinoline-3-carboxamide |
| SMILES | CCCC(CNc1nc2ccc(C)cc2cc1C(=O)/N=C(\C)N)OC |
| InChI | InChI=1S/C19H26N4O2/c1-5-6-15(25-4)11-21-18-16(19(24)22-13(3)20)10-14-9-12(2)7-8-17(14)23-18/h7-10,15H,5-6,11H2,1-4H3,(H,21,23)(H2,20,22,24) |
| InChIKey | HMSAASPMBPYJQK-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 89.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|