C24H35N3O2 — CID 139324725
1-[2-[[(2S)-3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinolin-3-yl]ethanone (PubChem CID 139324725) has the molecular formula C24H35N3O2 and a molecular weight of 397.56 g/mol. Its IUPAC name is 1-[2-[[(2S)-3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinolin-3-yl]ethanone.
| Compound Name | 1-[2-[[(2S)-3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinolin-3-yl]ethanone |
|---|---|
| PubChem CID | 139324725 |
| Molecular Formula | C24H35N3O2 |
| Molecular Weight | 397.56 g/mol |
| Exact Mass | 397.27 |
| IUPAC Name | 1-[2-[[(2S)-3-(cyclohexylamino)-2-methoxypentyl]amino]-6-methylquinolin-3-yl]ethanone |
| SMILES | CCC(NC1CCCCC1)[C@H](CNc1nc2ccc(C)cc2cc1C(C)=O)OC |
| InChI | InChI=1S/C24H35N3O2/c1-5-21(26-19-9-7-6-8-10-19)23(29-4)15-25-24-20(17(3)28)14-18-13-16(2)11-12-22(18)27-24/h11-14,19,21,23,26H,5-10,15H2,1-4H3,(H,25,27)/t21?,23-/m0/s1 |
| InChIKey | JPIPYWRHEFKZCT-YANBTOMASA-N |
| XLogP | 4.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.56 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |