C22H35N5O — CID 123452707
N-(1-aminoethyl)-2-[3-(pentan-3-ylamino)pentylamino]quinoline-3-carboxamide (PubChem CID 123452707) has the molecular formula C22H35N5O and a molecular weight of 385.56 g/mol. Its IUPAC name is N-(1-aminoethyl)-2-[3-(pentan-3-ylamino)pentylamino]quinoline-3-carboxamide.
| Compound Name | N-(1-aminoethyl)-2-[3-(pentan-3-ylamino)pentylamino]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 123452707 |
| Molecular Formula | C22H35N5O |
| Molecular Weight | 385.56 g/mol |
| Exact Mass | 385.28 |
| IUPAC Name | N-(1-aminoethyl)-2-[3-(pentan-3-ylamino)pentylamino]quinoline-3-carboxamide |
| SMILES | CCC(CC)NC(CC)CCNc1nc2ccccc2cc1C(=O)NC(C)N |
| InChI | InChI=1S/C22H35N5O/c1-5-17(6-2)26-18(7-3)12-13-24-21-19(22(28)25-15(4)23)14-16-10-8-9-11-20(16)27-21/h8-11,14-15,17-18,26H,5-7,12-13,23H2,1-4H3,(H,24,27)(H,25,28) |
| InChIKey | KMDVJYNCGSUXJJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 92.07 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.56 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|