C22H38FN5O — CID 144575969
1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]-3-N-pentan-3-ylpentane-1,3-diamine;ethanol (PubChem CID 144575969) has the molecular formula C22H38FN5O and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]-3-N-pentan-3-ylpentane-1,3-diamine;ethanol.
| Compound Name | 1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]-3-N-pentan-3-ylpentane-1,3-diamine;ethanol |
|---|---|
| PubChem CID | 144575969 |
| Molecular Formula | C22H38FN5O |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.31 |
| IUPAC Name | 1-N-[3-(diaminomethyl)-6-fluoroquinolin-2-yl]-3-N-pentan-3-ylpentane-1,3-diamine;ethanol |
| SMILES | CCC(CC)NC(CC)CCNc1nc2ccc(F)cc2cc1C(N)N.CCO |
| InChI | InChI=1S/C20H32FN5.C2H6O/c1-4-15(5-2)25-16(6-3)9-10-24-20-17(19(22)23)12-13-11-14(21)7-8-18(13)26-20;1-2-3/h7-8,11-12,15-16,19,25H,4-6,9-10,22-23H2,1-3H3,(H,24,26);3H,2H2,1H3 |
| InChIKey | MVAMESWQDLFSSB-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 109.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|