C21H27N5O2 — CID 139324686
N-(1-aminoethylidene)-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide (PubChem CID 139324686) has the molecular formula C21H27N5O2 and a molecular weight of 381.48 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide.
| Compound Name | N-(1-aminoethylidene)-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide |
|---|---|
| PubChem CID | 139324686 |
| Molecular Formula | C21H27N5O2 |
| Molecular Weight | 381.48 g/mol |
| Exact Mass | 381.22 |
| IUPAC Name | N-(1-aminoethylidene)-2-[4-(oxolan-3-ylamino)piperidin-1-yl]quinoline-3-carboxamide |
| SMILES | C/C(N)=N\C(=O)c1cc2ccccc2nc1N1CCC(NC2CCOC2)CC1 |
| InChI | InChI=1S/C21H27N5O2/c1-14(22)23-21(27)18-12-15-4-2-3-5-19(15)25-20(18)26-9-6-16(7-10-26)24-17-8-11-28-13-17/h2-5,12,16-17,24H,6-11,13H2,1H3,(H2,22,23,27) |
| InChIKey | KJPUZUPKDQMBQW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.48 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|