C21H31ClN5O+ — CID 149341207
[N-(1-aminoethyl)-C-[7-chloro-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium (PubChem CID 149341207) has the molecular formula C21H31ClN5O+ and a molecular weight of 404.97 g/mol. Its IUPAC name is [N-(1-aminoethyl)-C-[7-chloro-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium.
| Compound Name | [N-(1-aminoethyl)-C-[7-chloro-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
|---|---|
| PubChem CID | 149341207 |
| Molecular Formula | C21H31ClN5O+ |
| Molecular Weight | 404.97 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | [N-(1-aminoethyl)-C-[7-chloro-2-[4-(2-methylpropylamino)piperidin-1-yl]quinolin-3-yl]carbonimidoyl]oxidanium |
| SMILES | CC(C)CNC1CCN(c2nc3cc(Cl)ccc3cc2C([OH2+])=NC(C)N)CC1 |
| InChI | InChI=1S/C21H30ClN5O/c1-13(2)12-24-17-6-8-27(9-7-17)20-18(21(28)25-14(3)23)10-15-4-5-16(22)11-19(15)26-20/h4-5,10-11,13-14,17,24H,6-9,12,23H2,1-3H3,(H,25,28)/p+1 |
| InChIKey | YEFBFLGGEFQWJT-UHFFFAOYSA-O |
| XLogP | 2.88 |
| TPSA | 89.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|