C25H34FN5O2 — CID 123491507
N-(1-aminoethylidene)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-7-fluoro-8-methylquinoline-3-carboxamide (PubChem CID 123491507) has the molecular formula C25H34FN5O2 and a molecular weight of 455.58 g/mol. Its IUPAC name is N-(1-aminoethylidene)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-7-fluoro-8-methylquinoline-3-carboxamide.
| Compound Name | N-(1-aminoethylidene)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-7-fluoro-8-methylquinoline-3-carboxamide |
|---|---|
| PubChem CID | 123491507 |
| Molecular Formula | C25H34FN5O2 |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | N-(1-aminoethylidene)-2-[4-(cyclohexylamino)-3-methoxypiperidin-1-yl]-7-fluoro-8-methylquinoline-3-carboxamide |
| SMILES | COC1CN(c2nc3c(C)c(F)ccc3cc2C(=O)/N=C(\C)N)CCC1NC1CCCCC1 |
| InChI | InChI=1S/C25H34FN5O2/c1-15-20(26)10-9-17-13-19(25(32)28-16(2)27)24(30-23(15)17)31-12-11-21(22(14-31)33-3)29-18-7-5-4-6-8-18/h9-10,13,18,21-22,29H,4-8,11-12,14H2,1-3H3,(H2,27,28,32) |
| InChIKey | VZHQLGUSOUASGR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 92.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|