C13H27NO — CID 118265066
1-(butan-2-ylamino)-3-ethyl-3,4-dimethylpentan-2-one (PubChem CID 118265066) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 1-(butan-2-ylamino)-3-ethyl-3,4-dimethylpentan-2-one.
| Compound Name | 1-(butan-2-ylamino)-3-ethyl-3,4-dimethylpentan-2-one |
|---|---|
| PubChem CID | 118265066 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 1-(butan-2-ylamino)-3-ethyl-3,4-dimethylpentan-2-one |
| SMILES | CCC(C)NCC(=O)C(C)(CC)C(C)C |
| InChI | InChI=1S/C13H27NO/c1-7-11(5)14-9-12(15)13(6,8-2)10(3)4/h10-11,14H,7-9H2,1-6H3 |
| InChIKey | YJVCOTROEMZJFN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |