C19H24N8O2S — CID 118266265
6-[(4-aminocyclohexyl)methyl]-3-(6-amino-3-pyridinyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 118266265) has the molecular formula C19H24N8O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is 6-[(4-aminocyclohexyl)methyl]-3-(6-amino-3-pyridinyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 6-[(4-aminocyclohexyl)methyl]-3-(6-amino-3-pyridinyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 118266265 |
| Molecular Formula | C19H24N8O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.17 |
| IUPAC Name | 6-[(4-aminocyclohexyl)methyl]-3-(6-amino-3-pyridinyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | Nc1ccc(-c2ccc(CC3CCC(N)CC3)c(S(N)(=O)=O)c2-c2nn[nH]n2)cn1 |
| InChI | InChI=1S/C19H24N8O2S/c20-14-5-1-11(2-6-14)9-12-3-7-15(13-4-8-16(21)23-10-13)17(18(12)30(22,28)29)19-24-26-27-25-19/h3-4,7-8,10-11,14H,1-2,5-6,9,20H2,(H2,21,23)(H2,22,28,29)(H,24,25,26,27) |
| InChIKey | VWWVYKZXEGKFTL-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 179.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |