C23H28N6O2S — CID 144893629
3-[4-(azetidin-3-yl)phenyl]-6-(cyclohexylmethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 144893629) has the molecular formula C23H28N6O2S and a molecular weight of 452.58 g/mol. Its IUPAC name is 3-[4-(azetidin-3-yl)phenyl]-6-(cyclohexylmethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-[4-(azetidin-3-yl)phenyl]-6-(cyclohexylmethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 144893629 |
| Molecular Formula | C23H28N6O2S |
| Molecular Weight | 452.58 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[4-(azetidin-3-yl)phenyl]-6-(cyclohexylmethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | NS(=O)(=O)c1c(CC2CCCCC2)ccc(-c2ccc(C3CNC3)cc2)c1-c1nn[nH]n1 |
| InChI | InChI=1S/C23H28N6O2S/c24-32(30,31)22-18(12-15-4-2-1-3-5-15)10-11-20(21(22)23-26-28-29-27-23)17-8-6-16(7-9-17)19-13-25-14-19/h6-11,15,19,25H,1-5,12-14H2,(H2,24,30,31)(H,26,27,28,29) |
| InChIKey | CCPSMWJZKAVRJK-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.58 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |