C25H37N5O2S — CID 144893211
3-(cyclohexylmethyl)-6-(4-pyrrolidin-3-ylphenyl)-2-sulfamoylbenzenecarboximidamide;methanamine (PubChem CID 144893211) has the molecular formula C25H37N5O2S and a molecular weight of 471.67 g/mol. Its IUPAC name is 3-(cyclohexylmethyl)-6-(4-pyrrolidin-3-ylphenyl)-2-sulfamoylbenzenecarboximidamide;methanamine.
| Compound Name | 3-(cyclohexylmethyl)-6-(4-pyrrolidin-3-ylphenyl)-2-sulfamoylbenzenecarboximidamide;methanamine |
|---|---|
| PubChem CID | 144893211 |
| Molecular Formula | C25H37N5O2S |
| Molecular Weight | 471.67 g/mol |
| Exact Mass | 471.27 |
| IUPAC Name | 3-(cyclohexylmethyl)-6-(4-pyrrolidin-3-ylphenyl)-2-sulfamoylbenzenecarboximidamide;methanamine |
| SMILES | CN.[H]/N=C(\N)c1c(-c2ccc(C3CCNC3)cc2)ccc(CC2CCCCC2)c1S(N)(=O)=O |
| InChI | InChI=1S/C24H32N4O2S.CH5N/c25-24(26)22-21(18-8-6-17(7-9-18)20-12-13-28-15-20)11-10-19(23(22)31(27,29)30)14-16-4-2-1-3-5-16;1-2/h6-11,16,20,28H,1-5,12-15H2,(H3,25,26)(H2,27,29,30);2H2,1H3 |
| InChIKey | KHYSZWZZIDPLHS-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 148.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.67 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|