C20H25N7O2S — CID 122694450
3-(6-amino-3-pyridinyl)-6-(2-cyclohexylethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide (PubChem CID 122694450) has the molecular formula C20H25N7O2S and a molecular weight of 427.53 g/mol. Its IUPAC name is 3-(6-amino-3-pyridinyl)-6-(2-cyclohexylethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide.
| Compound Name | 3-(6-amino-3-pyridinyl)-6-(2-cyclohexylethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 122694450 |
| Molecular Formula | C20H25N7O2S |
| Molecular Weight | 427.53 g/mol |
| Exact Mass | 427.18 |
| IUPAC Name | 3-(6-amino-3-pyridinyl)-6-(2-cyclohexylethyl)-2-(2H-tetrazol-5-yl)benzenesulfonamide |
| SMILES | Nc1ccc(-c2ccc(CCC3CCCCC3)c(S(N)(=O)=O)c2-c2nn[nH]n2)cn1 |
| InChI | InChI=1S/C20H25N7O2S/c21-17-11-9-15(12-23-17)16-10-8-14(7-6-13-4-2-1-3-5-13)19(30(22,28)29)18(16)20-24-26-27-25-20/h8-13H,1-7H2,(H2,21,23)(H2,22,28,29)(H,24,25,26,27) |
| InChIKey | NSUJYAOCCGWUGJ-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 153.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.53 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |