C15H11N5OS — CID 118267192
2-(1H-indazol-6-ylmethylsulfanyl)-5-pyridin-4-yl-1,3,4-oxadiazole (PubChem CID 118267192) has the molecular formula C15H11N5OS and a molecular weight of 309.35 g/mol. Its IUPAC name is 2-(1H-indazol-6-ylmethylsulfanyl)-5-pyridin-4-yl-1,3,4-oxadiazole.
| Compound Name | 2-(1H-indazol-6-ylmethylsulfanyl)-5-pyridin-4-yl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 118267192 |
| Molecular Formula | C15H11N5OS |
| Molecular Weight | 309.35 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 2-(1H-indazol-6-ylmethylsulfanyl)-5-pyridin-4-yl-1,3,4-oxadiazole |
| SMILES | c1cc(-c2nnc(SCc3ccc4cn[nH]c4c3)o2)ccn1 |
| InChI | InChI=1S/C15H11N5OS/c1-2-12-8-17-18-13(12)7-10(1)9-22-15-20-19-14(21-15)11-3-5-16-6-4-11/h1-8H,9H2,(H,17,18) |
| InChIKey | JFKBORPCUDTVET-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.35 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |