C21H48O4Si4 — CID 11826898
tert-butyl-dimethyl-[(1R,4R,5R)-3,4,5-tris(trimethylsilyloxy)cyclohex-2-en-1-yl]oxysilane (PubChem CID 11826898) has the molecular formula C21H48O4Si4 and a molecular weight of 476.96 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(1R,4R,5R)-3,4,5-tris(trimethylsilyloxy)cyclohex-2-en-1-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(1R,4R,5R)-3,4,5-tris(trimethylsilyloxy)cyclohex-2-en-1-yl]oxysilane |
|---|---|
| PubChem CID | 11826898 |
| Molecular Formula | C21H48O4Si4 |
| Molecular Weight | 476.96 g/mol |
| Exact Mass | 476.26 |
| IUPAC Name | tert-butyl-dimethyl-[(1R,4R,5R)-3,4,5-tris(trimethylsilyloxy)cyclohex-2-en-1-yl]oxysilane |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C=C(O[Si](C)(C)C)[C@H](O[Si](C)(C)C)[C@H](O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C21H48O4Si4/c1-21(2,3)29(13,14)22-17-15-18(23-26(4,5)6)20(25-28(10,11)12)19(16-17)24-27(7,8)9/h15,17,19-20H,16H2,1-14H3/t17-,19+,20-/m0/s1 |
| InChIKey | WURJHWPVCXMHAN-SXLOBPIMSA-N |
| XLogP | 6.96 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.96 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|