C23H40N4O7 — CID 11826993
(8S,11R,12S)-12-N-hydroxy-11-(2-methylpropyl)-2,10-dioxo-8-N-[[(2R)-oxolan-2-yl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide (PubChem CID 11826993) has the molecular formula C23H40N4O7 and a molecular weight of 484.59 g/mol. Its IUPAC name is (8S,11R,12S)-12-N-hydroxy-11-(2-methylpropyl)-2,10-dioxo-8-N-[[(2R)-oxolan-2-yl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide.
| Compound Name | (8S,11R,12S)-12-N-hydroxy-11-(2-methylpropyl)-2,10-dioxo-8-N-[[(2R)-oxolan-2-yl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
|---|---|
| PubChem CID | 11826993 |
| Molecular Formula | C23H40N4O7 |
| Molecular Weight | 484.59 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | (8S,11R,12S)-12-N-hydroxy-11-(2-methylpropyl)-2,10-dioxo-8-N-[[(2R)-oxolan-2-yl]methyl]-1-oxa-3,9-diazacyclopentadecane-8,12-dicarboxamide |
| SMILES | CC(C)C[C@H]1C(=O)N[C@H](C(=O)NC[C@H]2CCCO2)CCCCNC(=O)OCCC[C@@H]1C(=O)NO |
| InChI | InChI=1S/C23H40N4O7/c1-15(2)13-18-17(21(29)27-32)8-6-12-34-23(31)24-10-4-3-9-19(26-20(18)28)22(30)25-14-16-7-5-11-33-16/h15-19,32H,3-14H2,1-2H3,(H,24,31)(H,25,30)(H,26,28)(H,27,29)/t16-,17+,18-,19+/m1/s1 |
| InChIKey | BLOFXBALQSQAJS-HCXYKTFWSA-N |
| XLogP | 1.24 |
| TPSA | 155.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.59 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|