C31H27F2N3O — CID 11827137
2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-6-cyclopropyl-4-(furan-2-yl)benzonitrile (PubChem CID 11827137) has the molecular formula C31H27F2N3O and a molecular weight of 495.57 g/mol. Its IUPAC name is 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-6-cyclopropyl-4-(furan-2-yl)benzonitrile.
| Compound Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-6-cyclopropyl-4-(furan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 11827137 |
| Molecular Formula | C31H27F2N3O |
| Molecular Weight | 495.57 g/mol |
| Exact Mass | 495.21 |
| IUPAC Name | 2-[4-[bis(4-fluorophenyl)methyl]piperazin-1-yl]-6-cyclopropyl-4-(furan-2-yl)benzonitrile |
| SMILES | N#Cc1c(C2CC2)cc(-c2ccco2)cc1N1CCN(C(c2ccc(F)cc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C31H27F2N3O/c32-25-9-5-22(6-10-25)31(23-7-11-26(33)12-8-23)36-15-13-35(14-16-36)29-19-24(30-2-1-17-37-30)18-27(21-3-4-21)28(29)20-34/h1-2,5-12,17-19,21,31H,3-4,13-16H2 |
| InChIKey | UVGZPCYIWLJREO-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 43.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.57 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |