C21H35N2O4+ — CID 118272058
trimethyl-[2-[(4S)-6-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptoxy]ethyl]azanium (PubChem CID 118272058) has the molecular formula C21H35N2O4+ and a molecular weight of 379.52 g/mol. Its IUPAC name is trimethyl-[2-[(4S)-6-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptoxy]ethyl]azanium.
| Compound Name | trimethyl-[2-[(4S)-6-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptoxy]ethyl]azanium |
|---|---|
| PubChem CID | 118272058 |
| Molecular Formula | C21H35N2O4+ |
| Molecular Weight | 379.52 g/mol |
| Exact Mass | 379.26 |
| IUPAC Name | trimethyl-[2-[(4S)-6-methyl-3-oxo-4-(phenylmethoxycarbonylamino)heptoxy]ethyl]azanium |
| SMILES | CC(C)C[C@H](NC(=O)OCc1ccccc1)C(=O)CCOCC[N+](C)(C)C |
| InChI | InChI=1S/C21H34N2O4/c1-17(2)15-19(20(24)11-13-26-14-12-23(3,4)5)22-21(25)27-16-18-9-7-6-8-10-18/h6-10,17,19H,11-16H2,1-5H3/p+1/t19-/m0/s1 |
| InChIKey | ATKPWKUHHVLSKI-IBGZPJMESA-O |
| XLogP | 3.01 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|