C21H39IO5Si — CID 11827509
[(3S,4R)-3-acetyloxy-2-iodo-8-tri(propan-2-yl)silyloxyoct-1-en-4-yl] acetate (PubChem CID 11827509) has the molecular formula C21H39IO5Si and a molecular weight of 526.53 g/mol. Its IUPAC name is [(3S,4R)-3-acetyloxy-2-iodo-8-tri(propan-2-yl)silyloxyoct-1-en-4-yl] acetate.
| Compound Name | [(3S,4R)-3-acetyloxy-2-iodo-8-tri(propan-2-yl)silyloxyoct-1-en-4-yl] acetate |
|---|---|
| PubChem CID | 11827509 |
| Molecular Formula | C21H39IO5Si |
| Molecular Weight | 526.53 g/mol |
| Exact Mass | 526.16 |
| IUPAC Name | [(3S,4R)-3-acetyloxy-2-iodo-8-tri(propan-2-yl)silyloxyoct-1-en-4-yl] acetate |
| SMILES | C=C(I)[C@@H](OC(C)=O)[C@@H](CCCCO[Si](C(C)C)(C(C)C)C(C)C)OC(C)=O |
| InChI | InChI=1S/C21H39IO5Si/c1-14(2)28(15(3)4,16(5)6)25-13-11-10-12-20(26-18(8)23)21(17(7)22)27-19(9)24/h14-16,20-21H,7,10-13H2,1-6,8-9H3/t20-,21-/m1/s1 |
| InChIKey | TYOCSLHNYYOXLB-NHCUHLMSSA-N |
| XLogP | 6.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.53 |
| LogP ≤ 5 | 6.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|