C24H17N5O5 — CID 118275488
4-[5-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]-2,4-dinitroanilino]benzonitrile (PubChem CID 118275488) has the molecular formula C24H17N5O5 and a molecular weight of 455.43 g/mol. Its IUPAC name is 4-[5-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]-2,4-dinitroanilino]benzonitrile.
| Compound Name | 4-[5-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]-2,4-dinitroanilino]benzonitrile |
|---|---|
| PubChem CID | 118275488 |
| Molecular Formula | C24H17N5O5 |
| Molecular Weight | 455.43 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | 4-[5-[4-(1-cyanoethenyl)-2,6-dimethylphenoxy]-2,4-dinitroanilino]benzonitrile |
| SMILES | C=C(C#N)c1cc(C)c(Oc2cc(Nc3ccc(C#N)cc3)c([N+](=O)[O-])cc2[N+](=O)[O-])c(C)c1 |
| InChI | InChI=1S/C24H17N5O5/c1-14-8-18(16(3)12-25)9-15(2)24(14)34-23-10-20(21(28(30)31)11-22(23)29(32)33)27-19-6-4-17(13-26)5-7-19/h4-11,27H,3H2,1-2H3 |
| InChIKey | UDZIVUKFBQPGKE-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 155.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.43 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|