C21H18BrN3O6 — CID 46854243
5-(4-bromo-2,6-dimethylphenoxy)-N-(4-methoxyphenyl)-2,4-dinitroaniline (PubChem CID 46854243) has the molecular formula C21H18BrN3O6 and a molecular weight of 488.29 g/mol. Its IUPAC name is 5-(4-bromo-2,6-dimethylphenoxy)-N-(4-methoxyphenyl)-2,4-dinitroaniline.
| Compound Name | 5-(4-bromo-2,6-dimethylphenoxy)-N-(4-methoxyphenyl)-2,4-dinitroaniline |
|---|---|
| PubChem CID | 46854243 |
| Molecular Formula | C21H18BrN3O6 |
| Molecular Weight | 488.29 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | 5-(4-bromo-2,6-dimethylphenoxy)-N-(4-methoxyphenyl)-2,4-dinitroaniline |
| SMILES | COc1ccc(Nc2cc(Oc3c(C)cc(Br)cc3C)c([N+](=O)[O-])cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C21H18BrN3O6/c1-12-8-14(22)9-13(2)21(12)31-20-10-17(18(24(26)27)11-19(20)25(28)29)23-15-4-6-16(30-3)7-5-15/h4-11,23H,1-3H3 |
| InChIKey | BZECQWAMTMGJEJ-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 116.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.29 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|