C26H25FN4O — CID 118279725
N-[4-[2-(1-aminopentan-2-yl)quinolin-6-yl]-2-pyridinyl]-3-fluorobenzamide (PubChem CID 118279725) has the molecular formula C26H25FN4O and a molecular weight of 428.51 g/mol. Its IUPAC name is N-[4-[2-(1-aminopentan-2-yl)quinolin-6-yl]-2-pyridinyl]-3-fluorobenzamide.
| Compound Name | N-[4-[2-(1-aminopentan-2-yl)quinolin-6-yl]-2-pyridinyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 118279725 |
| Molecular Formula | C26H25FN4O |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.20 |
| IUPAC Name | N-[4-[2-(1-aminopentan-2-yl)quinolin-6-yl]-2-pyridinyl]-3-fluorobenzamide |
| SMILES | CCCC(CN)c1ccc2cc(-c3ccnc(NC(=O)c4cccc(F)c4)c3)ccc2n1 |
| InChI | InChI=1S/C26H25FN4O/c1-2-4-21(16-28)24-10-8-19-13-17(7-9-23(19)30-24)18-11-12-29-25(15-18)31-26(32)20-5-3-6-22(27)14-20/h3,5-15,21H,2,4,16,28H2,1H3,(H,29,31,32) |
| InChIKey | UBEXUIBPBNHEEW-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |