C13H13N5O2S — CID 118280387
1-[2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)ethyl]triazole-4-carbaldehyde (PubChem CID 118280387) has the molecular formula C13H13N5O2S and a molecular weight of 303.35 g/mol. Its IUPAC name is 1-[2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)ethyl]triazole-4-carbaldehyde.
| Compound Name | 1-[2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)ethyl]triazole-4-carbaldehyde |
|---|---|
| PubChem CID | 118280387 |
| Molecular Formula | C13H13N5O2S |
| Molecular Weight | 303.35 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | 1-[2-(6-ethyl-4-oxothieno[2,3-d]pyrimidin-3-yl)ethyl]triazole-4-carbaldehyde |
| SMILES | CCc1cc2c(=O)n(CCn3cc(C=O)nn3)cnc2s1 |
| InChI | InChI=1S/C13H13N5O2S/c1-2-10-5-11-12(21-10)14-8-17(13(11)20)3-4-18-6-9(7-19)15-16-18/h5-8H,2-4H2,1H3 |
| InChIKey | SGEYDKFJCRYYRF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 82.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|