C16H17N3O2S — CID 94751726
3-[2-(4-aminophenoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one (PubChem CID 94751726) has the molecular formula C16H17N3O2S and a molecular weight of 315.40 g/mol. Its IUPAC name is 3-[2-(4-aminophenoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 3-[2-(4-aminophenoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 94751726 |
| Molecular Formula | C16H17N3O2S |
| Molecular Weight | 315.40 g/mol |
| Exact Mass | 315.10 |
| IUPAC Name | 3-[2-(4-aminophenoxy)ethyl]-6-ethylthieno[2,3-d]pyrimidin-4-one |
| SMILES | CCc1cc2c(=O)n(CCOc3ccc(N)cc3)cnc2s1 |
| InChI | InChI=1S/C16H17N3O2S/c1-2-13-9-14-15(22-13)18-10-19(16(14)20)7-8-21-12-5-3-11(17)4-6-12/h3-6,9-10H,2,7-8,17H2,1H3 |
| InChIKey | VXFOVLIWZQMNHZ-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.40 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|