About (4-nitropyrazol-1-yl) propanoate
(4-nitropyrazol-1-yl) propanoate (PubChem CID 118280556) has the molecular formula C6H7N3O4
and a molecular weight of 185.14 g/mol. Its IUPAC name is (4-nitropyrazol-1-yl) propanoate.
Molecular Properties
| Compound Name | (4-nitropyrazol-1-yl) propanoate |
| PubChem CID | 118280556 |
| Molecular Formula | C6H7N3O4 |
| Molecular Weight | 185.14 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | (4-nitropyrazol-1-yl) propanoate |
| SMILES | CCC(=O)On1cc([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C6H7N3O4/c1-2-6(10)13-8-4-5(3-7-8)9(11)12/h3-4H,2H2,1H3 |
| InChIKey | RMJAQSGKJDKLAS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.14 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (4-nitropyrazol-1-yl) propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-nitropyrazol-1-yl) propanoate?
The IUPAC name of (4-nitropyrazol-1-yl) propanoate (CID 118280556) is (4-nitropyrazol-1-yl) propanoate.
What is the SMILES notation for (4-nitropyrazol-1-yl) propanoate?
The canonical SMILES for (4-nitropyrazol-1-yl) propanoate is CCC(=O)On1cc([N+](=O)[O-])cn1.
What is the InChIKey of (4-nitropyrazol-1-yl) propanoate?
The InChIKey is RMJAQSGKJDKLAS-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N3O4/c1-2-6(10)13-8-4-5(3-7-8)9(11)12/h3-4H,2H2,1H3.
What are the key properties of (4-nitropyrazol-1-yl) propanoate?
(4-nitropyrazol-1-yl) propanoate has a molecular weight of 185.14 g/mol, XLogP of 0.16, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4-nitropyrazol-1-yl) propanoate is sourced from PubChem (CID 118280556), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).