C15H21F2NO3S — CID 118280652
[(2R)-2-(difluoromethyl)piperidin-4-yl] (2R)-2-phenylpropane-1-sulfonate (PubChem CID 118280652) has the molecular formula C15H21F2NO3S and a molecular weight of 333.40 g/mol. Its IUPAC name is [(2R)-2-(difluoromethyl)piperidin-4-yl] (2R)-2-phenylpropane-1-sulfonate.
| Compound Name | [(2R)-2-(difluoromethyl)piperidin-4-yl] (2R)-2-phenylpropane-1-sulfonate |
|---|---|
| PubChem CID | 118280652 |
| Molecular Formula | C15H21F2NO3S |
| Molecular Weight | 333.40 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [(2R)-2-(difluoromethyl)piperidin-4-yl] (2R)-2-phenylpropane-1-sulfonate |
| SMILES | C[C@@H](CS(=O)(=O)OC1CCN[C@@H](C(F)F)C1)c1ccccc1 |
| InChI | InChI=1S/C15H21F2NO3S/c1-11(12-5-3-2-4-6-12)10-22(19,20)21-13-7-8-18-14(9-13)15(16)17/h2-6,11,13-15,18H,7-10H2,1H3/t11-,13?,14+/m0/s1 |
| InChIKey | OXBQKZGMWKOFOQ-JDZGAICCSA-N |
| XLogP | 2.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|