C30H41N7O3 — CID 118280965
(2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[3-[2-(6-tert-butyl-3H-indol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol (PubChem CID 118280965) has the molecular formula C30H41N7O3 and a molecular weight of 547.70 g/mol. Its IUPAC name is (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[3-[2-(6-tert-butyl-3H-indol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol.
| Compound Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[3-[2-(6-tert-butyl-3H-indol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 118280965 |
| Molecular Formula | C30H41N7O3 |
| Molecular Weight | 547.70 g/mol |
| Exact Mass | 547.33 |
| IUPAC Name | (2R,3R,4S,5R)-2-(6-aminopurin-9-yl)-5-[[[3-[2-(6-tert-butyl-3H-indol-2-yl)ethyl]cyclobutyl]-ethylamino]methyl]oxolane-3,4-diol |
| SMILES | CCN(C[C@H]1O[C@@H](n2cnc3c(N)ncnc32)[C@H](O)[C@@H]1O)C1CC(CCC2=Nc3cc(C(C)(C)C)ccc3C2)C1 |
| InChI | InChI=1S/C30H41N7O3/c1-5-36(14-23-25(38)26(39)29(40-23)37-16-34-24-27(31)32-15-33-28(24)37)21-10-17(11-21)6-9-20-12-18-7-8-19(30(2,3)4)13-22(18)35-20/h7-8,13,15-17,21,23,25-26,29,38-39H,5-6,9-12,14H2,1-4H3,(H2,31,32,33)/t17?,21?,23-,25-,26-,29-/m1/s1 |
| InChIKey | MOZMHHFKIRAUCN-TZVJDHOGSA-N |
| XLogP | 3.53 |
| TPSA | 134.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.70 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |