C26H38FN3O9P2 — CID 11828239
7-[4-[bis(diethoxyphosphoryl)methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid (PubChem CID 11828239) has the molecular formula C26H38FN3O9P2 and a molecular weight of 617.55 g/mol. Its IUPAC name is 7-[4-[bis(diethoxyphosphoryl)methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-[4-[bis(diethoxyphosphoryl)methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 11828239 |
| Molecular Formula | C26H38FN3O9P2 |
| Molecular Weight | 617.55 g/mol |
| Exact Mass | 617.21 |
| IUPAC Name | 7-[4-[bis(diethoxyphosphoryl)methyl]piperazin-1-yl]-1-cyclopropyl-6-fluoro-4-oxoquinoline-3-carboxylic acid |
| SMILES | CCOP(=O)(OCC)C(N1CCN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3C2CC2)CC1)P(=O)(OCC)OCC |
| InChI | InChI=1S/C26H38FN3O9P2/c1-5-36-40(34,37-6-2)26(41(35,38-7-3)39-8-4)29-13-11-28(12-14-29)23-16-22-19(15-21(23)27)24(31)20(25(32)33)17-30(22)18-9-10-18/h15-18,26H,5-14H2,1-4H3,(H,32,33) |
| InChIKey | RVGHKHGPYXZSOD-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 136.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.55 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|