About 2,6-diethyl-1-methylindole
2,6-diethyl-1-methylindole (PubChem CID 118283612) has the molecular formula C13H17N
and a molecular weight of 187.29 g/mol. Its IUPAC name is 2,6-diethyl-1-methylindole.
Molecular Properties
| Compound Name | 2,6-diethyl-1-methylindole |
| PubChem CID | 118283612 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | 2,6-diethyl-1-methylindole |
| SMILES | CCc1ccc2cc(CC)n(C)c2c1 |
| InChI | InChI=1S/C13H17N/c1-4-10-6-7-11-9-12(5-2)14(3)13(11)8-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | KECJAZIBMKALLB-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-diethyl-1-methylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-diethyl-1-methylindole?
The IUPAC name of 2,6-diethyl-1-methylindole (CID 118283612) is 2,6-diethyl-1-methylindole.
What is the SMILES notation for 2,6-diethyl-1-methylindole?
The canonical SMILES for 2,6-diethyl-1-methylindole is CCc1ccc2cc(CC)n(C)c2c1.
What is the InChIKey of 2,6-diethyl-1-methylindole?
The InChIKey is KECJAZIBMKALLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17N/c1-4-10-6-7-11-9-12(5-2)14(3)13(11)8-10/h6-9H,4-5H2,1-3H3.
What are the key properties of 2,6-diethyl-1-methylindole?
2,6-diethyl-1-methylindole has a molecular weight of 187.29 g/mol, XLogP of 3.30, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-diethyl-1-methylindole is sourced from PubChem (CID 118283612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).