C18H21NO2 — CID 118284103
4-propan-2-yl-5-(4-propan-2-ylanilino)cyclohexa-3,5-diene-1,2-dione (PubChem CID 118284103) has the molecular formula C18H21NO2 and a molecular weight of 283.37 g/mol. Its IUPAC name is 4-propan-2-yl-5-(4-propan-2-ylanilino)cyclohexa-3,5-diene-1,2-dione.
| Compound Name | 4-propan-2-yl-5-(4-propan-2-ylanilino)cyclohexa-3,5-diene-1,2-dione |
|---|---|
| PubChem CID | 118284103 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 4-propan-2-yl-5-(4-propan-2-ylanilino)cyclohexa-3,5-diene-1,2-dione |
| SMILES | CC(C)C1=CC(=O)C(=O)C=C1Nc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C18H21NO2/c1-11(2)13-5-7-14(8-6-13)19-16-10-18(21)17(20)9-15(16)12(3)4/h5-12,19H,1-4H3 |
| InChIKey | ZJLVTLXUSDOJQH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|