C33H37N5O3 — CID 118284758
N-[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxy-N-methyl-4-morpholin-4-ylbutan-1-amine (PubChem CID 118284758) has the molecular formula C33H37N5O3 and a molecular weight of 551.69 g/mol. Its IUPAC name is N-[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxy-N-methyl-4-morpholin-4-ylbutan-1-amine.
| Compound Name | N-[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxy-N-methyl-4-morpholin-4-ylbutan-1-amine |
|---|---|
| PubChem CID | 118284758 |
| Molecular Formula | C33H37N5O3 |
| Molecular Weight | 551.69 g/mol |
| Exact Mass | 551.29 |
| IUPAC Name | N-[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxy-N-methyl-4-morpholin-4-ylbutan-1-amine |
| SMILES | CN(CCCCN1CCOCC1)Oc1c(Cc2ccco2)nc2c(Cc3ccccc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C33H37N5O3/c1-36(16-8-9-17-37-18-21-39-22-19-37)41-33-30(24-28-15-10-20-40-28)35-32-29(23-26-11-4-2-5-12-26)34-31(25-38(32)33)27-13-6-3-7-14-27/h2-7,10-15,20,25H,8-9,16-19,21-24H2,1H3 |
| InChIKey | YMDVFPHESXKBBE-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 68.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.69 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|