C33H35N3O6 — CID 137379350
[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 3-(2-methoxyethoxy)-2,2-dimethylpropanoate (PubChem CID 137379350) has the molecular formula C33H35N3O6 and a molecular weight of 569.66 g/mol. Its IUPAC name is [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 3-(2-methoxyethoxy)-2,2-dimethylpropanoate.
| Compound Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 3-(2-methoxyethoxy)-2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 137379350 |
| Molecular Formula | C33H35N3O6 |
| Molecular Weight | 569.66 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 3-(2-methoxyethoxy)-2,2-dimethylpropanoate |
| SMILES | COCCOCC(C)(C)C(=O)OCOc1c(Cc2ccco2)nc2c(Cc3ccccc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C33H35N3O6/c1-33(2,22-39-18-17-38-3)32(37)42-23-41-31-28(20-26-15-10-16-40-26)35-30-27(19-24-11-6-4-7-12-24)34-29(21-36(30)31)25-13-8-5-9-14-25/h4-16,21H,17-20,22-23H2,1-3H3 |
| InChIKey | HGPOJBYHYFQCJP-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 97.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.66 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|