C32H31N3O4 — CID 58960216
[2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]oxymethyl 2,2-dimethylpropanoate (PubChem CID 58960216) has the molecular formula C32H31N3O4 and a molecular weight of 521.62 g/mol. Its IUPAC name is [2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]oxymethyl 2,2-dimethylpropanoate.
| Compound Name | [2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]oxymethyl 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 58960216 |
| Molecular Formula | C32H31N3O4 |
| Molecular Weight | 521.62 g/mol |
| Exact Mass | 521.23 |
| IUPAC Name | [2,8-dibenzyl-6-(4-hydroxyphenyl)imidazo[1,2-a]pyrazin-3-yl]oxymethyl 2,2-dimethylpropanoate |
| SMILES | CC(C)(C)C(=O)OCOc1c(Cc2ccccc2)nc2c(Cc3ccccc3)nc(-c3ccc(O)cc3)cn12 |
| InChI | InChI=1S/C32H31N3O4/c1-32(2,3)31(37)39-21-38-30-27(19-23-12-8-5-9-13-23)34-29-26(18-22-10-6-4-7-11-22)33-28(20-35(29)30)24-14-16-25(36)17-15-24/h4-17,20,36H,18-19,21H2,1-3H3 |
| InChIKey | NDTHZLCMGGNKCM-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.62 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|