C29H27N3O5 — CID 137398828
[8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 2-hydroxy-2-methylpropanoate (PubChem CID 137398828) has the molecular formula C29H27N3O5 and a molecular weight of 497.55 g/mol. Its IUPAC name is [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 2-hydroxy-2-methylpropanoate.
| Compound Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 2-hydroxy-2-methylpropanoate |
|---|---|
| PubChem CID | 137398828 |
| Molecular Formula | C29H27N3O5 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.20 |
| IUPAC Name | [8-benzyl-2-(furan-2-ylmethyl)-6-phenylimidazo[1,2-a]pyrazin-3-yl]oxymethyl 2-hydroxy-2-methylpropanoate |
| SMILES | CC(C)(O)C(=O)OCOc1c(Cc2ccco2)nc2c(Cc3ccccc3)nc(-c3ccccc3)cn12 |
| InChI | InChI=1S/C29H27N3O5/c1-29(2,34)28(33)37-19-36-27-24(17-22-14-9-15-35-22)31-26-23(16-20-10-5-3-6-11-20)30-25(18-32(26)27)21-12-7-4-8-13-21/h3-15,18,34H,16-17,19H2,1-2H3 |
| InChIKey | AZKSVWBIXGJPMT-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 99.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|